About [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate (PubChem CID 141231126) has the molecular formula C12H16O9
and a molecular weight of 304.25 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate |
| PubChem CID | 141231126 |
| Molecular Formula | C12H16O9 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate |
| SMILES | C=CCOC1=C(OC(=O)C(O)CO)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C12H16O9/c1-2-3-19-10-9(21-11(17)7(16)5-14)8(6(15)4-13)20-12(10)18/h2,6-8,13-16H,1,3-5H2/t6-,7?,8+/m0/s1 |
| InChIKey | IHVLEJNRCGLGFL-YPVSKDHRSA-N |
| XLogP | -2.42 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate?
The IUPAC name of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate (CID 141231126) is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate.
What is the SMILES notation for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate?
The canonical SMILES for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate is C=CCOC1=C(OC(=O)C(O)CO)[C@@H]([C@@H](O)CO)OC1=O.
What is the InChIKey of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate?
The InChIKey is IHVLEJNRCGLGFL-YPVSKDHRSA-N. The full InChI is InChI=1S/C12H16O9/c1-2-3-19-10-9(21-11(17)7(16)5-14)8(6(15)4-13)20-12(10)18/h2,6-8,13-16H,1,3-5H2/t6-,7?,8+/m0/s1.
What are the key properties of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate?
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate has a molecular weight of 304.25 g/mol, XLogP of -2.42, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-prop-2-enoxy-2H-furan-3-yl] 2,3-dihydroxypropanoate is sourced from PubChem (CID 141231126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).