C13H20O7 — CID 168860286
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-4-prop-2-enoxy-2H-furan-5-one (PubChem CID 168860286) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-4-prop-2-enoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-4-prop-2-enoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 168860286 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-4-prop-2-enoxy-2H-furan-5-one |
| SMILES | C=CCOC1=C(OCC(C)(C)O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C13H20O7/c1-4-5-18-11-10(19-7-13(2,3)17)9(8(15)6-14)20-12(11)16/h4,8-9,14-15,17H,1,5-7H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | XAGYZEFYWRINCF-DTWKUNHWSA-N |
| XLogP | -0.53 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|