C16H28O8 — CID 140562720
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2,3-dihydroxypropoxy)-4-heptoxy-2H-furan-5-one (PubChem CID 140562720) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2,3-dihydroxypropoxy)-4-heptoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2,3-dihydroxypropoxy)-4-heptoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 140562720 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2,3-dihydroxypropoxy)-4-heptoxy-2H-furan-5-one |
| SMILES | CCCCCCCOC1=C(OCC(O)CO)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C16H28O8/c1-2-3-4-5-6-7-22-15-14(23-10-11(19)8-17)13(12(20)9-18)24-16(15)21/h11-13,17-20H,2-10H2,1H3/t11?,12-,13+/m0/s1 |
| InChIKey | HIZUNTUSKSBSMI-LWNNLKQOSA-N |
| XLogP | -0.17 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|