C16H28O6 — CID 68591726
(2R)-4-decoxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one (PubChem CID 68591726) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is (2R)-4-decoxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-4-decoxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 68591726 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2R)-4-decoxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one |
| SMILES | CCCCCCCCCCOC1=C(O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C16H28O6/c1-2-3-4-5-6-7-8-9-10-21-15-13(19)14(12(18)11-17)22-16(15)20/h12,14,17-19H,2-11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | SDKQYVPXZWYMPB-GXTWGEPZSA-N |
| XLogP | 2.19 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|