C25H46O8 — CID 67267014
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-3-octoxypropoxy)-4-octoxy-2H-furan-5-one (PubChem CID 67267014) has the molecular formula C25H46O8 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-3-octoxypropoxy)-4-octoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-3-octoxypropoxy)-4-octoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 67267014 |
| Molecular Formula | C25H46O8 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-(2-hydroxy-3-octoxypropoxy)-4-octoxy-2H-furan-5-one |
| SMILES | CCCCCCCCOCC(O)COC1=C(OCCCCCCCC)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C25H46O8/c1-3-5-7-9-11-13-15-30-18-20(27)19-32-23-22(21(28)17-26)33-25(29)24(23)31-16-14-12-10-8-6-4-2/h20-22,26-28H,3-19H2,1-2H3/t20?,21-,22+/m0/s1 |
| InChIKey | OUJGCGJYPBMOLI-JTGIGXABSA-N |
| XLogP | 3.61 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|