C17H30O8 — CID 171063088
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-[(2R)-2,3-dihydroxypropoxy]-3-octoxy-2H-furan-5-one (PubChem CID 171063088) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-[(2R)-2,3-dihydroxypropoxy]-3-octoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-[(2R)-2,3-dihydroxypropoxy]-3-octoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 171063088 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-[(2R)-2,3-dihydroxypropoxy]-3-octoxy-2H-furan-5-one |
| SMILES | CCCCCCCCOC1=C(OC[C@H](O)CO)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C17H30O8/c1-2-3-4-5-6-7-8-23-15-14(13(21)10-19)25-17(22)16(15)24-11-12(20)9-18/h12-14,18-21H,2-11H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | KGJNUVYFBQMMFS-HZSPNIEDSA-N |
| XLogP | 0.22 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|