C18H31O10P — CID 178181872
[(2R)-3-(2-hydroxy-2-methylpropoxy)-2-[(1S)-1-hydroxy-2-oct-1-enoxyethyl]-5-oxo-2H-furan-4-yl] dihydrogen phosphate (PubChem CID 178181872) has the molecular formula C18H31O10P and a molecular weight of 438.41 g/mol. Its IUPAC name is [(2R)-3-(2-hydroxy-2-methylpropoxy)-2-[(1S)-1-hydroxy-2-oct-1-enoxyethyl]-5-oxo-2H-furan-4-yl] dihydrogen phosphate.
| Compound Name | [(2R)-3-(2-hydroxy-2-methylpropoxy)-2-[(1S)-1-hydroxy-2-oct-1-enoxyethyl]-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 178181872 |
| Molecular Formula | C18H31O10P |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(2R)-3-(2-hydroxy-2-methylpropoxy)-2-[(1S)-1-hydroxy-2-oct-1-enoxyethyl]-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
| SMILES | CCCCCCC=COC[C@H](O)[C@H]1OC(=O)C(OP(=O)(O)O)=C1OCC(C)(C)O |
| InChI | InChI=1S/C18H31O10P/c1-4-5-6-7-8-9-10-25-11-13(19)14-15(26-12-18(2,3)21)16(17(20)27-14)28-29(22,23)24/h9-10,13-14,19,21H,4-8,11-12H2,1-3H3,(H2,22,23,24)/t13-,14+/m0/s1 |
| InChIKey | JTYRBISDHYWVRX-UONOGXRCSA-N |
| XLogP | 1.88 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|