C14H25O10P — CID 178181870
[(2R)-2-[(1S)-2-butoxy-1-hydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-5-oxo-2H-furan-4-yl] dihydrogen phosphate (PubChem CID 178181870) has the molecular formula C14H25O10P and a molecular weight of 384.32 g/mol. Its IUPAC name is [(2R)-2-[(1S)-2-butoxy-1-hydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-5-oxo-2H-furan-4-yl] dihydrogen phosphate.
| Compound Name | [(2R)-2-[(1S)-2-butoxy-1-hydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 178181870 |
| Molecular Formula | C14H25O10P |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2R)-2-[(1S)-2-butoxy-1-hydroxyethyl]-3-(2-hydroxy-2-methylpropoxy)-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
| SMILES | CCCCOC[C@H](O)[C@H]1OC(=O)C(OP(=O)(O)O)=C1OCC(C)(C)O |
| InChI | InChI=1S/C14H25O10P/c1-4-5-6-21-7-9(15)10-11(22-8-14(2,3)17)12(13(16)23-10)24-25(18,19)20/h9-10,15,17H,4-8H2,1-3H3,(H2,18,19,20)/t9-,10+/m0/s1 |
| InChIKey | ZQVRZQZLQAXBQB-VHSXEESVSA-N |
| XLogP | 0.20 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|