C7H8O7 — CID 118281516
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] formate (PubChem CID 118281516) has the molecular formula C7H8O7 and a molecular weight of 204.13 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] formate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] formate |
|---|---|
| PubChem CID | 118281516 |
| Molecular Formula | C7H8O7 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] formate |
| SMILES | O=COC1=C(O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C7H8O7/c8-1-3(10)5-4(11)6(13-2-9)7(12)14-5/h2-3,5,8,10-11H,1H2/t3-,5+/m0/s1 |
| InChIKey | HCVKDFNQOXYDHC-WVZVXSGGSA-N |
| XLogP | -1.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|