C6H8O8S — CID 71144881
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfite (PubChem CID 71144881) has the molecular formula C6H8O8S and a molecular weight of 240.19 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfite.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 71144881 |
| Molecular Formula | C6H8O8S |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] hydrogen sulfite |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1OS(=O)O |
| InChI | InChI=1S/C6H8O8S/c7-1-2(8)4-3(9)5(6(10)13-4)14-15(11)12/h2,4,7-9H,1H2,(H,11,12)/t2-,4+/m0/s1 |
| InChIKey | ZNPJRJYMMVIQIC-ZAFYKAAXSA-N |
| XLogP | -1.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|