C6H7O9P — CID 90048246
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxy]-2H-furan-5-one (PubChem CID 90048246) has the molecular formula C6H7O9P and a molecular weight of 254.09 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxy]-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxy]-2H-furan-5-one |
|---|---|
| PubChem CID | 90048246 |
| Molecular Formula | C6H7O9P |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(3-oxo-1,2,3λ5-dioxaphosphiran-3-yl)oxy]-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP1(=O)OO1 |
| InChI | InChI=1S/C6H7O9P/c7-1-2(8)4-3(9)5(6(10)12-4)13-16(11)14-15-16/h2,4,7-9H,1H2/t2-,4+/m0/s1 |
| InChIKey | QMMKRNKTRFXSBV-ZAFYKAAXSA-N |
| XLogP | -0.88 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|