C10H14O6 — CID 10585525
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-methoxy-3-prop-2-enoxy-2H-furan-5-one (PubChem CID 10585525) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-methoxy-3-prop-2-enoxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-methoxy-3-prop-2-enoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 10585525 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-methoxy-3-prop-2-enoxy-2H-furan-5-one |
| SMILES | C=CCOC1=C(OC)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C10H14O6/c1-3-4-15-8-7(6(12)5-11)16-10(13)9(8)14-2/h3,6-7,11-12H,1,4-5H2,2H3/t6-,7+/m0/s1 |
| InChIKey | FCPSGCXTJAMSRJ-NKWVEPMBSA-N |
| XLogP | -0.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|