C9H12O8 — CID 174859483
2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;prop-2-enoic acid (PubChem CID 174859483) has the molecular formula C9H12O8 and a molecular weight of 248.19 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;prop-2-enoic acid.
| Compound Name | 2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;prop-2-enoic acid |
|---|---|
| PubChem CID | 174859483 |
| Molecular Formula | C9H12O8 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C1OC(C(O)CO)C(O)=C1O |
| InChI | InChI=1S/C6H8O6.C3H4O2/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-2-3(4)5/h2,5,7-10H,1H2;2H,1H2,(H,4,5) |
| InChIKey | HJKGIPSWWFRSOI-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|