About [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium
[2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium (PubChem CID 148577016) has the molecular formula C9H12NO8+
and a molecular weight of 262.19 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium.
Molecular Properties
| Compound Name | [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium |
| PubChem CID | 148577016 |
| Molecular Formula | C9H12NO8+ |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium |
| SMILES | CC(=O)C(=O)OC1=C(O[NH3+])C(C(O)CO)OC1=O |
| InChI | InChI=1S/C9H12NO8/c1-3(12)8(14)17-7-6(18-10)5(4(13)2-11)16-9(7)15/h4-5,11,13H,2H2,1,10H3/q+1 |
| InChIKey | MXZPKQSCUYFGSP-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium?
The IUPAC name of [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium (CID 148577016) is [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium.
What is the SMILES notation for [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium?
The canonical SMILES for [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium is CC(=O)C(=O)OC1=C(O[NH3+])C(C(O)CO)OC1=O.
What is the InChIKey of [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium?
The InChIKey is MXZPKQSCUYFGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO8/c1-3(12)8(14)17-7-6(18-10)5(4(13)2-11)16-9(7)15/h4-5,11,13H,2H2,1,10H3/q+1.
What are the key properties of [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium?
[2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium has a molecular weight of 262.19 g/mol, XLogP of -3.22, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium is sourced from PubChem (CID 148577016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).