C9H12NO8+ — CID 148577016
[2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium (PubChem CID 148577016) has the molecular formula C9H12NO8+ and a molecular weight of 262.19 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium.
| Compound Name | [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium |
|---|---|
| PubChem CID | 148577016 |
| Molecular Formula | C9H12NO8+ |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-5-oxo-4-(2-oxopropanoyloxy)-2H-furan-3-yl]oxyazanium |
| SMILES | CC(=O)C(=O)OC1=C(O[NH3+])C(C(O)CO)OC1=O |
| InChI | InChI=1S/C9H12NO8/c1-3(12)8(14)17-7-6(18-10)5(4(13)2-11)16-9(7)15/h4-5,11,13H,2H2,1,10H3/q+1 |
| InChIKey | MXZPKQSCUYFGSP-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|