C14H19O12P — CID 59630926
[2-(3-hydroxy-5-oxo-4-phosphonooxy-2H-furan-2-yl)-2-propanoyloxyethyl] 4-oxopentanoate (PubChem CID 59630926) has the molecular formula C14H19O12P and a molecular weight of 410.27 g/mol. Its IUPAC name is [2-(3-hydroxy-5-oxo-4-phosphonooxy-2H-furan-2-yl)-2-propanoyloxyethyl] 4-oxopentanoate.
| Compound Name | [2-(3-hydroxy-5-oxo-4-phosphonooxy-2H-furan-2-yl)-2-propanoyloxyethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 59630926 |
| Molecular Formula | C14H19O12P |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [2-(3-hydroxy-5-oxo-4-phosphonooxy-2H-furan-2-yl)-2-propanoyloxyethyl] 4-oxopentanoate |
| SMILES | CCC(=O)OC(COC(=O)CCC(C)=O)C1OC(=O)C(OP(=O)(O)O)=C1O |
| InChI | InChI=1S/C14H19O12P/c1-3-9(16)24-8(6-23-10(17)5-4-7(2)15)12-11(18)13(14(19)25-12)26-27(20,21)22/h8,12,18H,3-6H2,1-2H3,(H2,20,21,22) |
| InChIKey | UEHKGTNDHBZHAU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|