C12H15NO11 — CID 91522034
2-[[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl]oxycarbonylamino]pentanedioic acid (PubChem CID 91522034) has the molecular formula C12H15NO11 and a molecular weight of 349.25 g/mol. Its IUPAC name is 2-[[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl]oxycarbonylamino]pentanedioic acid.
| Compound Name | 2-[[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl]oxycarbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 91522034 |
| Molecular Formula | C12H15NO11 |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl]oxycarbonylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)OC1C(=O)OC(C(O)CO)C1=O)C(=O)O |
| InChI | InChI=1S/C12H15NO11/c14-3-5(15)8-7(18)9(11(21)23-8)24-12(22)13-4(10(19)20)1-2-6(16)17/h4-5,8-9,14-15H,1-3H2,(H,13,22)(H,16,17)(H,19,20) |
| InChIKey | CQQPZYUHNQHBIM-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 196.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|