C16H23NO11 — CID 145497909
diethyl (2S)-2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate (PubChem CID 145497909) has the molecular formula C16H23NO11 and a molecular weight of 405.36 g/mol. Its IUPAC name is diethyl (2S)-2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 145497909 |
| Molecular Formula | C16H23NO11 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | diethyl (2S)-2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)OC1=C(O)C(C(O)CO)OC1=O)C(=O)OCC |
| InChI | InChI=1S/C16H23NO11/c1-3-25-10(20)6-5-8(14(22)26-4-2)17-16(24)28-13-11(21)12(9(19)7-18)27-15(13)23/h8-9,12,18-19,21H,3-7H2,1-2H3,(H,17,24)/t8-,9?,12?/m0/s1 |
| InChIKey | RZALBKREMMIUMH-QTZUAFFRSA-N |
| XLogP | -0.96 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|