C24H45O9P — CID 91414379
[(5R)-5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] 2-heptylundecyl hydrogen phosphate (PubChem CID 91414379) has the molecular formula C24H45O9P and a molecular weight of 508.59 g/mol. Its IUPAC name is [(5R)-5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] 2-heptylundecyl hydrogen phosphate.
| Compound Name | [(5R)-5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] 2-heptylundecyl hydrogen phosphate |
|---|---|
| PubChem CID | 91414379 |
| Molecular Formula | C24H45O9P |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [(5R)-5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] 2-heptylundecyl hydrogen phosphate |
| SMILES | CCCCCCCCCC(CCCCCCC)COP(=O)(O)OC1C(=O)O[C@H](C(O)CO)C1=O |
| InChI | InChI=1S/C24H45O9P/c1-3-5-7-9-10-12-14-16-19(15-13-11-8-6-4-2)18-31-34(29,30)33-23-21(27)22(20(26)17-25)32-24(23)28/h19-20,22-23,25-26H,3-18H2,1-2H3,(H,29,30)/t19?,20?,22-,23?/m1/s1 |
| InChIKey | ASMZAVCAIPSWMO-ADXQIFNLSA-N |
| XLogP | 4.45 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|