C7H11O9P — CID 90707891
[5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] methyl hydrogen phosphate (PubChem CID 90707891) has the molecular formula C7H11O9P and a molecular weight of 270.13 g/mol. Its IUPAC name is [5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90707891 |
| Molecular Formula | C7H11O9P |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | [5-(1,2-dihydroxyethyl)-2,4-dioxooxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC1C(=O)OC(C(O)CO)C1=O |
| InChI | InChI=1S/C7H11O9P/c1-14-17(12,13)16-6-4(10)5(3(9)2-8)15-7(6)11/h3,5-6,8-9H,2H2,1H3,(H,12,13) |
| InChIKey | SALOJKYOPKEURF-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|