C16H29NO2 — CID 57003776
(3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-butyloxolan-2-one (PubChem CID 57003776) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-butyloxolan-2-one.
| Compound Name | (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-butyloxolan-2-one |
|---|---|
| PubChem CID | 57003776 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (3R,5S)-5-[(1S)-1-amino-2-cyclohexylethyl]-3-butyloxolan-2-one |
| SMILES | CCCC[C@@H]1C[C@@H]([C@@H](N)CC2CCCCC2)OC1=O |
| InChI | InChI=1S/C16H29NO2/c1-2-3-9-13-11-15(19-16(13)18)14(17)10-12-7-5-4-6-8-12/h12-15H,2-11,17H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | AWLJRYXYRUDRAF-ILXRZTDVSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |