C22H31NO7 — CID 58773506
tert-butyl (2R,3R,4R)-3-(ethoxycarbonyloxymethyl)-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylate (PubChem CID 58773506) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R)-3-(ethoxycarbonyloxymethyl)-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R)-3-(ethoxycarbonyloxymethyl)-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58773506 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | tert-butyl (2R,3R,4R)-3-(ethoxycarbonyloxymethyl)-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)OC[C@@H]1[C@@H](CCOCc2ccccc2)C(=O)N[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31NO7/c1-5-28-21(26)29-14-17-16(11-12-27-13-15-9-7-6-8-10-15)19(24)23-18(17)20(25)30-22(2,3)4/h6-10,16-18H,5,11-14H2,1-4H3,(H,23,24)/t16-,17-,18-/m1/s1 |
| InChIKey | POCFDDUGUQTGTM-KZNAEPCWSA-N |
| XLogP | 2.84 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|