C20H23NO6 — CID 58773511
2-O-benzyl 2-O'-tert-butyl (2S,4R)-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 58773511) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-O-benzyl 2-O'-tert-butyl (2S,4R)-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | 2-O-benzyl 2-O'-tert-butyl (2S,4R)-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 58773511 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-O-benzyl 2-O'-tert-butyl (2S,4R)-3-methylidene-5-oxo-4-(2-oxoethyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | C=C1[C@@H](CC=O)C(=O)N[C@@]1(C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23NO6/c1-13-15(10-11-22)16(23)21-20(13,18(25)27-19(2,3)4)17(24)26-12-14-8-6-5-7-9-14/h5-9,11,15H,1,10,12H2,2-4H3,(H,21,23)/t15-,20+/m1/s1 |
| InChIKey | HANASWLMPPEWRZ-QRWLVFNGSA-N |
| XLogP | 1.70 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|