C25H29NO6 — CID 58773523
[(3S,6R,7R,7aR)-5-oxo-3-phenyl-6-(2-phenylmethoxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methyl ethyl carbonate (PubChem CID 58773523) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is [(3S,6R,7R,7aR)-5-oxo-3-phenyl-6-(2-phenylmethoxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methyl ethyl carbonate.
| Compound Name | [(3S,6R,7R,7aR)-5-oxo-3-phenyl-6-(2-phenylmethoxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methyl ethyl carbonate |
|---|---|
| PubChem CID | 58773523 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [(3S,6R,7R,7aR)-5-oxo-3-phenyl-6-(2-phenylmethoxyethyl)-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]methyl ethyl carbonate |
| SMILES | CCOC(=O)OC[C@@H]1[C@@H](CCOCc2ccccc2)C(=O)N2[C@H](c3ccccc3)OC[C@@H]12 |
| InChI | InChI=1S/C25H29NO6/c1-2-30-25(28)32-16-21-20(13-14-29-15-18-9-5-3-6-10-18)23(27)26-22(21)17-31-24(26)19-11-7-4-8-12-19/h3-12,20-22,24H,2,13-17H2,1H3/t20-,21-,22+,24+/m1/s1 |
| InChIKey | YIBFGNHKGAFXKW-SVPADUAOSA-N |
| XLogP | 3.94 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|