C20H25INO2- — CID 58773791
N-ethyl-6-(4-phenyliodanuidylphenoxy)hexanamide (PubChem CID 58773791) has the molecular formula C20H25INO2- and a molecular weight of 438.33 g/mol. Its IUPAC name is N-ethyl-6-(4-phenyliodanuidylphenoxy)hexanamide.
| Compound Name | N-ethyl-6-(4-phenyliodanuidylphenoxy)hexanamide |
|---|---|
| PubChem CID | 58773791 |
| Molecular Formula | C20H25INO2- |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-ethyl-6-(4-phenyliodanuidylphenoxy)hexanamide |
| SMILES | CCNC(=O)CCCCCOc1ccc([I-]c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25INO2/c1-2-22-20(23)11-7-4-8-16-24-19-14-12-18(13-15-19)21-17-9-5-3-6-10-17/h3,5-6,9-10,12-15H,2,4,7-8,11,16H2,1H3,(H,22,23)/q-1 |
| InChIKey | JWXUBWDGMAFMDM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|