C7H4NSV- — CID 58775540
7H-1,3-benzothiazol-7-ide;vanadium (PubChem CID 58775540) has the molecular formula C7H4NSV- and a molecular weight of 185.13 g/mol. Its IUPAC name is 7H-1,3-benzothiazol-7-ide;vanadium.
| Compound Name | 7H-1,3-benzothiazol-7-ide;vanadium |
|---|---|
| PubChem CID | 58775540 |
| Molecular Formula | C7H4NSV- |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 184.95 |
| IUPAC Name | 7H-1,3-benzothiazol-7-ide;vanadium |
| SMILES | [V].[c-]1cccc2ncsc12 |
| InChI | InChI=1S/C7H4NS.V/c1-2-4-7-6(3-1)8-5-9-7;/h1-3,5H;/q-1; |
| InChIKey | QEAMTHGBUWBPPH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|