About 4H-1,3-benzothiazol-4-ide;vanadium
4H-1,3-benzothiazol-4-ide;vanadium (PubChem CID 58775371) has the molecular formula C7H4NSV-
and a molecular weight of 185.13 g/mol. Its IUPAC name is 4H-1,3-benzothiazol-4-ide;vanadium.
Molecular Properties
| Compound Name | 4H-1,3-benzothiazol-4-ide;vanadium |
| PubChem CID | 58775371 |
| Molecular Formula | C7H4NSV- |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 184.95 |
| IUPAC Name | 4H-1,3-benzothiazol-4-ide;vanadium |
| SMILES | [V].[c-]1cccc2scnc12 |
| InChI | InChI=1S/C7H4NS.V/c1-2-4-7-6(3-1)8-5-9-7;/h1-2,4-5H;/q-1; |
| InChIKey | GRXYLSMYGRRHCJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4H-1,3-benzothiazol-4-ide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,3-benzothiazol-4-ide;vanadium?
The IUPAC name of 4H-1,3-benzothiazol-4-ide;vanadium (CID 58775371) is 4H-1,3-benzothiazol-4-ide;vanadium.
What is the SMILES notation for 4H-1,3-benzothiazol-4-ide;vanadium?
The canonical SMILES for 4H-1,3-benzothiazol-4-ide;vanadium is [V].[c-]1cccc2scnc12.
What is the InChIKey of 4H-1,3-benzothiazol-4-ide;vanadium?
The InChIKey is GRXYLSMYGRRHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4NS.V/c1-2-4-7-6(3-1)8-5-9-7;/h1-2,4-5H;/q-1;.
What are the key properties of 4H-1,3-benzothiazol-4-ide;vanadium?
4H-1,3-benzothiazol-4-ide;vanadium has a molecular weight of 185.13 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,3-benzothiazol-4-ide;vanadium is sourced from PubChem (CID 58775371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).