C7H4NSY- — CID 170523142
7H-1,3-benzothiazol-7-ide;yttrium (PubChem CID 170523142) has the molecular formula C7H4NSY- and a molecular weight of 223.09 g/mol. Its IUPAC name is 7H-1,3-benzothiazol-7-ide;yttrium.
| Compound Name | 7H-1,3-benzothiazol-7-ide;yttrium |
|---|---|
| PubChem CID | 170523142 |
| Molecular Formula | C7H4NSY- |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 222.91 |
| IUPAC Name | 7H-1,3-benzothiazol-7-ide;yttrium |
| SMILES | [Y].[c-]1cccc2ncsc12 |
| InChI | InChI=1S/C7H4NS.Y/c1-2-4-7-6(3-1)8-5-9-7;/h1-3,5H;/q-1; |
| InChIKey | LTPROGCKGBCKOH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|