C21H24N4O2 — CID 58777497
2-[2-(dimethylamino)ethyl-methylamino]-N-(7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-2-yl)acetamide (PubChem CID 58777497) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-methylamino]-N-(7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-2-yl)acetamide.
| Compound Name | 2-[2-(dimethylamino)ethyl-methylamino]-N-(7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-2-yl)acetamide |
|---|---|
| PubChem CID | 58777497 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-methylamino]-N-(7-oxo-6-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8,10,12-hexaen-2-yl)acetamide |
| SMILES | CN(C)CCN(C)CC(=O)Nc1ccc2[nH]c(=O)c3cccc4c3c2c1C4 |
| InChI | InChI=1S/C21H24N4O2/c1-24(2)9-10-25(3)12-18(26)22-16-7-8-17-20-15(16)11-13-5-4-6-14(19(13)20)21(27)23-17/h4-8H,9-12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | KMTCIIXTNKFHPJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|