C12H25NO — CID 58778810
3-(methoxymethyl)-1,2-di(propan-2-yl)pyrrolidine (PubChem CID 58778810) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-(methoxymethyl)-1,2-di(propan-2-yl)pyrrolidine.
| Compound Name | 3-(methoxymethyl)-1,2-di(propan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 58778810 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3-(methoxymethyl)-1,2-di(propan-2-yl)pyrrolidine |
| SMILES | COCC1CCN(C(C)C)C1C(C)C |
| InChI | InChI=1S/C12H25NO/c1-9(2)12-11(8-14-5)6-7-13(12)10(3)4/h9-12H,6-8H2,1-5H3 |
| InChIKey | IKMFBHVEUMTNMS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |