C9H7F7 — CID 58779461
5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 58779461) has the molecular formula C9H7F7 and a molecular weight of 248.14 g/mol. Its IUPAC name is 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58779461 |
| Molecular Formula | C9H7F7 |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1C2C=CC(C2)C1(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F7/c10-7(9(14,15)16)5-2-1-4(3-5)6(7)8(11,12)13/h1-2,4-6H,3H2 |
| InChIKey | WVKKWJRSOFAZHG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|