About 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene
5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 58779461) has the molecular formula C9H7F7
and a molecular weight of 248.14 g/mol. Its IUPAC name is 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 58779461 |
| Molecular Formula | C9H7F7 |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1C2C=CC(C2)C1(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F7/c10-7(9(14,15)16)5-2-1-4(3-5)6(7)8(11,12)13/h1-2,4-6H,3H2 |
| InChIKey | WVKKWJRSOFAZHG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (CID 58779461) is 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is FC(F)(F)C1C2C=CC(C2)C1(F)C(F)(F)F.
What is the InChIKey of 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The InChIKey is WVKKWJRSOFAZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F7/c10-7(9(14,15)16)5-2-1-4(3-5)6(7)8(11,12)13/h1-2,4-6H,3H2.
What are the key properties of 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene has a molecular weight of 248.14 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 58779461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).