C10H19O4S+ — CID 58780013
dimethyl-[2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium (PubChem CID 58780013) has the molecular formula C10H19O4S+ and a molecular weight of 235.32 g/mol. Its IUPAC name is dimethyl-[2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium.
| Compound Name | dimethyl-[2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium |
|---|---|
| PubChem CID | 58780013 |
| Molecular Formula | C10H19O4S+ |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | dimethyl-[2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium |
| SMILES | CC(C)C(=O)OCCOC(=O)C[S+](C)C |
| InChI | InChI=1S/C10H19O4S/c1-8(2)10(12)14-6-5-13-9(11)7-15(3)4/h8H,5-7H2,1-4H3/q+1 |
| InChIKey | QSRHOIHYUHRGMC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|