C17H33O4S+ — CID 58780041
dibutyl-[2-[2-(2,2-dimethylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium (PubChem CID 58780041) has the molecular formula C17H33O4S+ and a molecular weight of 333.51 g/mol. Its IUPAC name is dibutyl-[2-[2-(2,2-dimethylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium.
| Compound Name | dibutyl-[2-[2-(2,2-dimethylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium |
|---|---|
| PubChem CID | 58780041 |
| Molecular Formula | C17H33O4S+ |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | dibutyl-[2-[2-(2,2-dimethylpropanoyloxy)ethoxy]-2-oxoethyl]sulfanium |
| SMILES | CCCC[S+](CCCC)CC(=O)OCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33O4S/c1-6-8-12-22(13-9-7-2)14-15(18)20-10-11-21-16(19)17(3,4)5/h6-14H2,1-5H3/q+1 |
| InChIKey | UZBQCINPRDQUDV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|