C18H35N3O4S — CID 58780616
tert-butyl 4-[1-cyclohexyl-2-(methanesulfonamido)ethyl]piperazine-1-carboxylate (PubChem CID 58780616) has the molecular formula C18H35N3O4S and a molecular weight of 389.56 g/mol. Its IUPAC name is tert-butyl 4-[1-cyclohexyl-2-(methanesulfonamido)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-cyclohexyl-2-(methanesulfonamido)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58780616 |
| Molecular Formula | C18H35N3O4S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl 4-[1-cyclohexyl-2-(methanesulfonamido)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(CNS(C)(=O)=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H35N3O4S/c1-18(2,3)25-17(22)21-12-10-20(11-13-21)16(14-19-26(4,23)24)15-8-6-5-7-9-15/h15-16,19H,5-14H2,1-4H3 |
| InChIKey | HJJCQTRVTKNCKF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |