C29H38N2O6S — CID 58780871
N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methoxy-5-methylperoxysulfanylbenzamide (PubChem CID 58780871) has the molecular formula C29H38N2O6S and a molecular weight of 542.70 g/mol. Its IUPAC name is N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methoxy-5-methylperoxysulfanylbenzamide.
| Compound Name | N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methoxy-5-methylperoxysulfanylbenzamide |
|---|---|
| PubChem CID | 58780871 |
| Molecular Formula | C29H38N2O6S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methoxy-5-methylperoxysulfanylbenzamide |
| SMILES | COOSc1cc(OC)cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@@H](C)C(=O)NC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C29H38N2O6S/c1-18(28(33)30-25-14-20-9-10-21(25)12-20)11-27(32)26(13-19-7-5-4-6-8-19)31-29(34)22-15-23(35-2)17-24(16-22)38-37-36-3/h4-8,15-18,20-21,25-27,32H,9-14H2,1-3H3,(H,30,33)(H,31,34)/t18-,20?,21?,25?,26+,27+/m1/s1 |
| InChIKey | AEBPTUHNXARNLM-OOEPTKCWSA-N |
| XLogP | 4.31 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|