C32H41N3O6S — CID 58780875
N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methylperoxysulfanyl-5-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 58780875) has the molecular formula C32H41N3O6S and a molecular weight of 595.76 g/mol. Its IUPAC name is N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methylperoxysulfanyl-5-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methylperoxysulfanyl-5-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 58780875 |
| Molecular Formula | C32H41N3O6S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | N-[(2S,3S,5R)-6-(2-bicyclo[2.2.1]heptanylamino)-3-hydroxy-5-methyl-6-oxo-1-phenylhexan-2-yl]-3-methylperoxysulfanyl-5-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | COOSc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](O)C[C@@H](C)C(=O)NC2CC3CCC2C3)cc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C32H41N3O6S/c1-20(31(38)33-27-16-22-10-11-23(27)14-22)13-29(36)28(15-21-7-4-3-5-8-21)34-32(39)24-17-25(35-12-6-9-30(35)37)19-26(18-24)42-41-40-2/h3-5,7-8,17-20,22-23,27-29,36H,6,9-16H2,1-2H3,(H,33,38)(H,34,39)/t20-,22?,23?,27?,28+,29+/m1/s1 |
| InChIKey | BMFDBXCRVONNPW-HUMIOPDMSA-N |
| XLogP | 4.43 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|