C20H31N3O2 — CID 58782541
tert-butyl N-[(1R)-3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylpropyl]carbamate (PubChem CID 58782541) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 58782541 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | tert-butyl N-[(1R)-3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCN1CC2CNCC2C1)c1ccccc1 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,3)25-19(24)22-18(15-7-5-4-6-8-15)9-10-23-13-16-11-21-12-17(16)14-23/h4-8,16-18,21H,9-14H2,1-3H3,(H,22,24)/t16?,17?,18-/m1/s1 |
| InChIKey | PKEBGVAAEZYFCV-DAWZGUTISA-N |
| XLogP | 2.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |