C21H33N3O2 — CID 68580369
tert-butyl N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylbutyl]carbamate (PubChem CID 68580369) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylbutyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylbutyl]carbamate |
|---|---|
| PubChem CID | 68580369 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | tert-butyl N-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1-phenylbutyl]carbamate |
| SMILES | CC(CC(NC(=O)OC(C)(C)C)c1ccccc1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C21H33N3O2/c1-15(24-13-17-11-22-12-18(17)14-24)10-19(16-8-6-5-7-9-16)23-20(25)26-21(2,3)4/h5-9,15,17-19,22H,10-14H2,1-4H3,(H,23,25) |
| InChIKey | RTIBISZCWPEBFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |