C22H37N3O2 — CID 69313098
tert-butyl N-[(1R)-2-[(2-methyl-1-piperidin-4-ylpropyl)amino]-1-phenylethyl]carbamate (PubChem CID 69313098) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-[(2-methyl-1-piperidin-4-ylpropyl)amino]-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-[(2-methyl-1-piperidin-4-ylpropyl)amino]-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 69313098 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | tert-butyl N-[(1R)-2-[(2-methyl-1-piperidin-4-ylpropyl)amino]-1-phenylethyl]carbamate |
| SMILES | CC(C)C(NC[C@H](NC(=O)OC(C)(C)C)c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C22H37N3O2/c1-16(2)20(18-11-13-23-14-12-18)24-15-19(17-9-7-6-8-10-17)25-21(26)27-22(3,4)5/h6-10,16,18-20,23-24H,11-15H2,1-5H3,(H,25,26)/t19-,20?/m0/s1 |
| InChIKey | DUNDSRCXLDMPDN-XJDOXCRVSA-N |
| XLogP | 3.87 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |