C8H12O3 — CID 58782940
CID 58782940 (PubChem CID 58782940) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol.
| Compound Name | CID 58782940 |
|---|---|
| PubChem CID | 58782940 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | — |
| SMILES | [CH]OCC(O)CC(=O)C(=C)C |
| InChI | InChI=1S/C8H12O3/c1-6(2)8(10)4-7(9)5-11-3/h3,7,9H,1,4-5H2,2H3 |
| InChIKey | BWZCXQJEULLDEG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|