C11H20N2O4Pt+2 — CID 58783103
cyclobutane-1,1-dicarboxylic acid;platinum(2+);[(2S)-pyrrolidin-2-yl]methanamine (PubChem CID 58783103) has the molecular formula C11H20N2O4Pt+2 and a molecular weight of 439.37 g/mol. Its IUPAC name is cyclobutane-1,1-dicarboxylic acid;platinum(2+);[(2S)-pyrrolidin-2-yl]methanamine.
| Compound Name | cyclobutane-1,1-dicarboxylic acid;platinum(2+);[(2S)-pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 58783103 |
| Molecular Formula | C11H20N2O4Pt+2 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | cyclobutane-1,1-dicarboxylic acid;platinum(2+);[(2S)-pyrrolidin-2-yl]methanamine |
| SMILES | NC[C@@H]1CCCN1.O=C(O)C1(C(=O)O)CCC1.[Pt+2] |
| InChI | InChI=1S/C6H8O4.C5H12N2.Pt/c7-4(8)6(5(9)10)2-1-3-6;6-4-5-2-1-3-7-5;/h1-3H2,(H,7,8)(H,9,10);5,7H,1-4,6H2;/q;;+2/t;5-;/m.0./s1 |
| InChIKey | XXUHLUDUCZQMDI-NXAOXGSFSA-N |
| XLogP | 0.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|