C22H30FNO6 — CID 58783504
4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 58783504) has the molecular formula C22H30FNO6 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 58783504 |
| Molecular Formula | C22H30FNO6 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[(4-fluorophenyl)methyl] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OC1CCCCC1)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H30FNO6/c1-22(2,3)30-21(27)24-18(13-19(25)29-17-7-5-4-6-8-17)20(26)28-14-15-9-11-16(23)12-10-15/h9-12,17-18H,4-8,13-14H2,1-3H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | MMKZIKCTJRLFPT-GOSISDBHSA-N |
| XLogP | 4.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|