C28H22Cl2N6O2S — CID 58784751
N-[(1Z,2S)-1-amino-1-hydroxyimino-3-phenylpropan-2-yl]-5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxamide (PubChem CID 58784751) has the molecular formula C28H22Cl2N6O2S and a molecular weight of 577.50 g/mol. Its IUPAC name is N-[(1Z,2S)-1-amino-1-hydroxyimino-3-phenylpropan-2-yl]-5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[(1Z,2S)-1-amino-1-hydroxyimino-3-phenylpropan-2-yl]-5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58784751 |
| Molecular Formula | C28H22Cl2N6O2S |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | N-[(1Z,2S)-1-amino-1-hydroxyimino-3-phenylpropan-2-yl]-5-[1-(3,4-dichlorophenyl)-3-pyridin-3-ylpyrazol-5-yl]thiophene-2-carboxamide |
| SMILES | N/C(=N\O)[C@H](Cc1ccccc1)NC(=O)c1ccc(-c2cc(-c3cccnc3)nn2-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C28H22Cl2N6O2S/c29-20-9-8-19(14-21(20)30)36-24(15-22(34-36)18-7-4-12-32-16-18)25-10-11-26(39-25)28(37)33-23(27(31)35-38)13-17-5-2-1-3-6-17/h1-12,14-16,23,38H,13H2,(H2,31,35)(H,33,37)/t23-/m0/s1 |
| InChIKey | JQSGKJJWMNNTQY-QHCPKHFHSA-N |
| XLogP | 6.06 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|