C23H20ClN3O4S — CID 58785209
2-[4-chloro-3-(4-cyano-2,6-dimethylphenoxy)phenyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 58785209) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is 2-[4-chloro-3-(4-cyano-2,6-dimethylphenoxy)phenyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-chloro-3-(4-cyano-2,6-dimethylphenoxy)phenyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 58785209 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[4-chloro-3-(4-cyano-2,6-dimethylphenoxy)phenyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1cc(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)ccc1Cl |
| InChI | InChI=1S/C23H20ClN3O4S/c1-14-9-17(13-25)10-15(2)23(14)31-21-11-16(3-8-20(21)24)12-22(28)27-18-4-6-19(7-5-18)32(26,29)30/h3-11H,12H2,1-2H3,(H,27,28)(H2,26,29,30) |
| InChIKey | VAKBPUNTLUUUBT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |