C49H99N7 — CID 58785251
N'-[3-[4-[3-(diaminomethylideneamino)propyl-[(Z)-octadec-9-enyl]amino]butyl-octadec-9-enylamino]propyl]ethanimidamide (PubChem CID 58785251) has the molecular formula C49H99N7 and a molecular weight of 786.38 g/mol. Its IUPAC name is N'-[3-[4-[3-(diaminomethylideneamino)propyl-[(Z)-octadec-9-enyl]amino]butyl-octadec-9-enylamino]propyl]ethanimidamide.
| Compound Name | N'-[3-[4-[3-(diaminomethylideneamino)propyl-[(Z)-octadec-9-enyl]amino]butyl-octadec-9-enylamino]propyl]ethanimidamide |
|---|---|
| PubChem CID | 58785251 |
| Molecular Formula | C49H99N7 |
| Molecular Weight | 786.38 g/mol |
| Exact Mass | 785.80 |
| IUPAC Name | N'-[3-[4-[3-(diaminomethylideneamino)propyl-[(Z)-octadec-9-enyl]amino]butyl-octadec-9-enylamino]propyl]ethanimidamide |
| SMILES | CCCCCCCCC=CCCCCCCCCN(CCCCN(CCCCCCCC/C=C\CCCCCCCC)CCCN=C(N)N)CCC/N=C(\C)N |
| InChI | InChI=1S/C49H99N7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-42-55(46-38-40-53-48(3)50)44-36-37-45-56(47-39-41-54-49(51)52)43-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21H,4-17,22-47H2,1-3H3,(H2,50,53)(H4,51,52,54)/b20-18?,21-19- |
| InChIKey | ICSPIYLUUVZJNA-ZAQCFQLDSA-N |
| XLogP | 12.88 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.38 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|