C19H23F3N2O — CID 58788218
1-ethyl-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]piperidin-4-amine (PubChem CID 58788218) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-ethyl-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]piperidin-4-amine.
| Compound Name | 1-ethyl-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 58788218 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-ethyl-N-[[5-[4-(trifluoromethyl)phenyl]furan-2-yl]methyl]piperidin-4-amine |
| SMILES | CCN1CCC(NCc2ccc(-c3ccc(C(F)(F)F)cc3)o2)CC1 |
| InChI | InChI=1S/C19H23F3N2O/c1-2-24-11-9-16(10-12-24)23-13-17-7-8-18(25-17)14-3-5-15(6-4-14)19(20,21)22/h3-8,16,23H,2,9-13H2,1H3 |
| InChIKey | KVSHDKQNSRJCPG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |