C19H23F3N2O — CID 87736787
1-ethyl-N-[[5-(2,3,5-trifluoro-4-methylphenyl)furan-2-yl]methyl]piperidin-4-amine (PubChem CID 87736787) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-ethyl-N-[[5-(2,3,5-trifluoro-4-methylphenyl)furan-2-yl]methyl]piperidin-4-amine.
| Compound Name | 1-ethyl-N-[[5-(2,3,5-trifluoro-4-methylphenyl)furan-2-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 87736787 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-ethyl-N-[[5-(2,3,5-trifluoro-4-methylphenyl)furan-2-yl]methyl]piperidin-4-amine |
| SMILES | CCN1CCC(NCc2ccc(-c3cc(F)c(C)c(F)c3F)o2)CC1 |
| InChI | InChI=1S/C19H23F3N2O/c1-3-24-8-6-13(7-9-24)23-11-14-4-5-17(25-14)15-10-16(20)12(2)18(21)19(15)22/h4-5,10,13,23H,3,6-9,11H2,1-2H3 |
| InChIKey | SVCDIBWTDHNIIX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|