C29H35N3O6S — CID 58788547
[3-[[(3S)-4-[5,5-dimethyl-4-(prop-2-enylcarbamoyl)-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 58788547) has the molecular formula C29H35N3O6S and a molecular weight of 553.68 g/mol. Its IUPAC name is [3-[[(3S)-4-[5,5-dimethyl-4-(prop-2-enylcarbamoyl)-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(3S)-4-[5,5-dimethyl-4-(prop-2-enylcarbamoyl)-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 58788547 |
| Molecular Formula | C29H35N3O6S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | [3-[[(3S)-4-[5,5-dimethyl-4-(prop-2-enylcarbamoyl)-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | C=CCNC(=O)C1N(C(=O)[C@@H](O)C(Cc2ccccc2)NC(=O)c2cccc(OC(C)=O)c2C)CSC1(C)C |
| InChI | InChI=1S/C29H35N3O6S/c1-6-15-30-27(36)25-29(4,5)39-17-32(25)28(37)24(34)22(16-20-11-8-7-9-12-20)31-26(35)21-13-10-14-23(18(21)2)38-19(3)33/h6-14,22,24-25,34H,1,15-17H2,2-5H3,(H,30,36)(H,31,35)/t22?,24-,25?/m0/s1 |
| InChIKey | SIOZTBXMHVXUKU-JYNIAERNSA-N |
| XLogP | 2.60 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|