C29H34N2O7S — CID 23396467
prop-2-enyl 3-[3-[(3-acetyloxy-2-methylbenzoyl)amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 23396467) has the molecular formula C29H34N2O7S and a molecular weight of 554.67 g/mol. Its IUPAC name is prop-2-enyl 3-[3-[(3-acetyloxy-2-methylbenzoyl)amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | prop-2-enyl 3-[3-[(3-acetyloxy-2-methylbenzoyl)amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 23396467 |
| Molecular Formula | C29H34N2O7S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | prop-2-enyl 3-[3-[(3-acetyloxy-2-methylbenzoyl)amino]-2-hydroxy-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | C=CCOC(=O)C1N(C(=O)C(O)C(Cc2ccccc2)NC(=O)c2cccc(OC(C)=O)c2C)CSC1(C)C |
| InChI | InChI=1S/C29H34N2O7S/c1-6-15-37-28(36)25-29(4,5)39-17-31(25)27(35)24(33)22(16-20-11-8-7-9-12-20)30-26(34)21-13-10-14-23(18(21)2)38-19(3)32/h6-14,22,24-25,33H,1,15-17H2,2-5H3,(H,30,34) |
| InChIKey | RVCRZXVXZSBARN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|