C29H32F5N3O6 — CID 11250516
[3-[[(2S,3S)-4-[(2S)-4,4-difluoro-3,3-dimethyl-2-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 11250516) has the molecular formula C29H32F5N3O6 and a molecular weight of 613.58 g/mol. Its IUPAC name is [3-[[(2S,3S)-4-[(2S)-4,4-difluoro-3,3-dimethyl-2-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(2S,3S)-4-[(2S)-4,4-difluoro-3,3-dimethyl-2-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 11250516 |
| Molecular Formula | C29H32F5N3O6 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | [3-[[(2S,3S)-4-[(2S)-4,4-difluoro-3,3-dimethyl-2-(2,2,2-trifluoroethylcarbamoyl)pyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)C(=O)N2CC(F)(F)C(C)(C)[C@H]2C(=O)NCC(F)(F)F)c1C |
| InChI | InChI=1S/C29H32F5N3O6/c1-16-19(11-8-12-21(16)43-17(2)38)24(40)36-20(13-18-9-6-5-7-10-18)22(39)26(42)37-15-28(30,31)27(3,4)23(37)25(41)35-14-29(32,33)34/h5-12,20,22-23,39H,13-15H2,1-4H3,(H,35,41)(H,36,40)/t20-,22-,23+/m0/s1 |
| InChIKey | JSFJUMBLEPSOOD-ACIOBRDBSA-N |
| XLogP | 3.17 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|