C35H26N4O5S — CID 58790668
[3-[4-[methyl-(2-pyridin-2-ylacetyl)amino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate (PubChem CID 58790668) has the molecular formula C35H26N4O5S and a molecular weight of 614.68 g/mol. Its IUPAC name is [3-[4-[methyl-(2-pyridin-2-ylacetyl)amino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate.
| Compound Name | [3-[4-[methyl-(2-pyridin-2-ylacetyl)amino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate |
|---|---|
| PubChem CID | 58790668 |
| Molecular Formula | C35H26N4O5S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | [3-[4-[methyl-(2-pyridin-2-ylacetyl)amino]phenyl]-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] furan-2-sulfonate |
| SMILES | CN(C(=O)Cc1ccccn1)c1ccc(-c2cnc3[nH]c4ccc(OS(=O)(=O)c5ccco5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H26N4O5S/c1-39(31(40)20-25-10-5-6-18-36-25)26-14-12-23(13-15-26)29-22-37-35-34(33(29)24-8-3-2-4-9-24)28-21-27(16-17-30(28)38-35)44-45(41,42)32-11-7-19-43-32/h2-19,21-22H,20H2,1H3,(H,37,38) |
| InChIKey | FTDWZCUXSQYXKC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|